C12H13NO2 — CID 6449395
(2E,4E)-6-hydroxy-6-phenylhexa-2,4-dienamide (PubChem CID 6449395) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2E,4E)-6-hydroxy-6-phenylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-6-hydroxy-6-phenylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 6449395 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2E,4E)-6-hydroxy-6-phenylhexa-2,4-dienamide |
| SMILES | NC(=O)/C=C/C=C/C(O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2/c13-12(15)9-5-4-8-11(14)10-6-2-1-3-7-10/h1-9,11,14H,(H2,13,15)/b8-4+,9-5+ |
| InChIKey | URLWEJZUYQZEJB-KBXRYBNXSA-N |
| XLogP | 1.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|