C11H19F2NO2S — CID 114150616
N-[(3,3-difluorocyclopentyl)methyl]-1,1-dioxothian-3-amine (PubChem CID 114150616) has the molecular formula C11H19F2NO2S and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[(3,3-difluorocyclopentyl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(3,3-difluorocyclopentyl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 114150616 |
| Molecular Formula | C11H19F2NO2S |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[(3,3-difluorocyclopentyl)methyl]-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCC2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C11H19F2NO2S/c12-11(13)4-3-9(6-11)7-14-10-2-1-5-17(15,16)8-10/h9-10,14H,1-8H2 |
| InChIKey | UISFUDCRCLZKOT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |