C9H15F2N — CID 130731920
N-[(3,3-difluorocyclobutyl)methyl]cyclobutanamine (PubChem CID 130731920) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]cyclobutanamine.
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 130731920 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]cyclobutanamine |
| SMILES | FC1(F)CC(CNC2CCC2)C1 |
| InChI | InChI=1S/C9H15F2N/c10-9(11)4-7(5-9)6-12-8-2-1-3-8/h7-8,12H,1-6H2 |
| InChIKey | AEFIIZBILNUXJS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |