C10H20N4O4 — CID 114152761
N-(3-amino-2-hydroxy-3-oxopropyl)-2-(carbamoylamino)-4-methylpentanamide (PubChem CID 114152761) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2-(carbamoylamino)-4-methylpentanamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(carbamoylamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 114152761 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(carbamoylamino)-4-methylpentanamide |
| SMILES | CC(C)CC(NC(N)=O)C(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C10H20N4O4/c1-5(2)3-6(14-10(12)18)9(17)13-4-7(15)8(11)16/h5-7,15H,3-4H2,1-2H3,(H2,11,16)(H,13,17)(H3,12,14,18) |
| InChIKey | UFLJYZDZJJJLJD-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |