C13H25N3O4 — CID 60637444
ethyl 4-[[2-(carbamoylamino)-4-methylpentanoyl]amino]butanoate (PubChem CID 60637444) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 4-[[2-(carbamoylamino)-4-methylpentanoyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(carbamoylamino)-4-methylpentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 60637444 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | ethyl 4-[[2-(carbamoylamino)-4-methylpentanoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)C(CC(C)C)NC(N)=O |
| InChI | InChI=1S/C13H25N3O4/c1-4-20-11(17)6-5-7-15-12(18)10(8-9(2)3)16-13(14)19/h9-10H,4-8H2,1-3H3,(H,15,18)(H3,14,16,19) |
| InChIKey | SZMLMNGJVKSCAR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|