C12H19ClN2O3 — CID 114153145
N-(1-chloro-3-methylpentan-3-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 114153145) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is N-(1-chloro-3-methylpentan-3-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(1-chloro-3-methylpentan-3-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 114153145 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(1-chloro-3-methylpentan-3-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCC(C)(CCCl)NC(=O)c1cc(COC)on1 |
| InChI | InChI=1S/C12H19ClN2O3/c1-4-12(2,5-6-13)14-11(16)10-7-9(8-17-3)18-15-10/h7H,4-6,8H2,1-3H3,(H,14,16) |
| InChIKey | KHROMOPJNCMNQF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|