C6H8N2O3 — CID 18521757
5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 18521757) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 18521757 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(N)=O)no1 |
| InChI | InChI=1S/C6H8N2O3/c1-10-3-4-2-5(6(7)9)8-11-4/h2H,3H2,1H3,(H2,7,9) |
| InChIKey | XJISISZPFKFZEU-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |