C6H9NO2 — CID 542401
5-(methoxymethyl)-3-methyl-1,2-oxazole (PubChem CID 542401) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-(methoxymethyl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(methoxymethyl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 542401 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-(methoxymethyl)-3-methyl-1,2-oxazole |
| SMILES | COCc1cc(C)no1 |
| InChI | InChI=1S/C6H9NO2/c1-5-3-6(4-8-2)9-7-5/h3H,4H2,1-2H3 |
| InChIKey | BIHKMPQQASOGPQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |