C13H11Cl3N2O — CID 114156926
[4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol (PubChem CID 114156926) has the molecular formula C13H11Cl3N2O and a molecular weight of 317.60 g/mol. Its IUPAC name is [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol.
| Compound Name | [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 114156926 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CNc2nc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H11Cl3N2O/c14-10-5-11(15)13(18-12(10)16)17-6-8-1-3-9(7-19)4-2-8/h1-5,19H,6-7H2,(H,17,18) |
| InChIKey | BHYQJRVHDDBACR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|