About [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol
[4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol (PubChem CID 114156926) has the molecular formula C13H11Cl3N2O
and a molecular weight of 317.60 g/mol. Its IUPAC name is [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol |
| PubChem CID | 114156926 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CNc2nc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H11Cl3N2O/c14-10-5-11(15)13(18-12(10)16)17-6-8-1-3-9(7-19)4-2-8/h1-5,19H,6-7H2,(H,17,18) |
| InChIKey | BHYQJRVHDDBACR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol?
The IUPAC name of [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol (CID 114156926) is [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol.
What is the SMILES notation for [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol?
The canonical SMILES for [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol is OCc1ccc(CNc2nc(Cl)c(Cl)cc2Cl)cc1.
What is the InChIKey of [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol?
The InChIKey is BHYQJRVHDDBACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl3N2O/c14-10-5-11(15)13(18-12(10)16)17-6-8-1-3-9(7-19)4-2-8/h1-5,19H,6-7H2,(H,17,18).
What are the key properties of [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol?
[4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol has a molecular weight of 317.60 g/mol, XLogP of 4.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]phenyl]methanol is sourced from PubChem (CID 114156926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).