C10H9Cl3N4 — CID 102751690
3,5,6-trichloro-N-[(1-methylpyrazol-3-yl)methyl]pyridin-2-amine (PubChem CID 102751690) has the molecular formula C10H9Cl3N4 and a molecular weight of 291.57 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(1-methylpyrazol-3-yl)methyl]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(1-methylpyrazol-3-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102751690 |
| Molecular Formula | C10H9Cl3N4 |
| Molecular Weight | 291.57 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 3,5,6-trichloro-N-[(1-methylpyrazol-3-yl)methyl]pyridin-2-amine |
| SMILES | Cn1ccc(CNc2nc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H9Cl3N4/c1-17-3-2-6(16-17)5-14-10-8(12)4-7(11)9(13)15-10/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | VZYXOWLYGVKIQZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|