C11H18ClN5 — CID 126965584
1-ethyl-4-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-3-amine;hydrochloride (PubChem CID 126965584) has the molecular formula C11H18ClN5 and a molecular weight of 255.75 g/mol. Its IUPAC name is 1-ethyl-4-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-3-amine;hydrochloride.
| Compound Name | 1-ethyl-4-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 126965584 |
| Molecular Formula | C11H18ClN5 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-ethyl-4-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-3-amine;hydrochloride |
| SMILES | CCn1cc(C)c(NCc2ccn(C)n2)n1.Cl |
| InChI | InChI=1S/C11H17N5.ClH/c1-4-16-8-9(2)11(14-16)12-7-10-5-6-15(3)13-10;/h5-6,8H,4,7H2,1-3H3,(H,12,14);1H |
| InChIKey | ZNKRJQXQCJRLSB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |