C12H16ClN5O — CID 114160296
4-chloro-6-morpholin-4-yl-N-pent-4-ynyl-1,3,5-triazin-2-amine (PubChem CID 114160296) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is 4-chloro-6-morpholin-4-yl-N-pent-4-ynyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-morpholin-4-yl-N-pent-4-ynyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114160296 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-chloro-6-morpholin-4-yl-N-pent-4-ynyl-1,3,5-triazin-2-amine |
| SMILES | C#CCCCNc1nc(Cl)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H16ClN5O/c1-2-3-4-5-14-11-15-10(13)16-12(17-11)18-6-8-19-9-7-18/h1H,3-9H2,(H,14,15,16,17) |
| InChIKey | SFJXWLGFQSKPQR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|