C12H14N2O5 — CID 114162738
3-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]benzoic acid (PubChem CID 114162738) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]benzoic acid.
| Compound Name | 3-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 114162738 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]benzoic acid |
| SMILES | NC(=O)COCCNC(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C12H14N2O5/c13-10(15)7-19-5-4-14-11(16)8-2-1-3-9(6-8)12(17)18/h1-3,6H,4-5,7H2,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | KNQNFSBFDCSFRC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|