C13H20N4O3 — CID 106233433
3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-4-(dimethylamino)benzamide (PubChem CID 106233433) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-4-(dimethylamino)benzamide.
| Compound Name | 3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 106233433 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)NCCOCC(N)=O)cc1N |
| InChI | InChI=1S/C13H20N4O3/c1-17(2)11-4-3-9(7-10(11)14)13(19)16-5-6-20-8-12(15)18/h3-4,7H,5-6,8,14H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | KPWLIFSIOHGADK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|