C16H38O3Si2 — CID 11416377
1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butan-2-ol (PubChem CID 11416377) has the molecular formula C16H38O3Si2 and a molecular weight of 334.65 g/mol. Its IUPAC name is 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butan-2-ol.
| Compound Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butan-2-ol |
|---|---|
| PubChem CID | 11416377 |
| Molecular Formula | C16H38O3Si2 |
| Molecular Weight | 334.65 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H38O3Si2/c1-15(2,3)20(7,8)18-12-11-14(17)13-19-21(9,10)16(4,5)6/h14,17H,11-13H2,1-10H3 |
| InChIKey | FVJUNFNHUYYLNB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|