C15H21BrF2O — CID 114166530
1-bromo-3-(2-ethylhexoxymethyl)-2,4-difluorobenzene (PubChem CID 114166530) has the molecular formula C15H21BrF2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-bromo-3-(2-ethylhexoxymethyl)-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-(2-ethylhexoxymethyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 114166530 |
| Molecular Formula | C15H21BrF2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-bromo-3-(2-ethylhexoxymethyl)-2,4-difluorobenzene |
| SMILES | CCCCC(CC)COCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H21BrF2O/c1-3-5-6-11(4-2)9-19-10-12-14(17)8-7-13(16)15(12)18/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | AWNZGIDXZMDWRI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|