C11H10BrN5 — CID 114168086
3-bromo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzonitrile (PubChem CID 114168086) has the molecular formula C11H10BrN5 and a molecular weight of 292.14 g/mol. Its IUPAC name is 3-bromo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 3-bromo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 114168086 |
| Molecular Formula | C11H10BrN5 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3-bromo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc(C#N)cc1Br)c1ncn[nH]1 |
| InChI | InChI=1S/C11H10BrN5/c1-7(11-14-6-15-17-11)16-10-3-2-8(5-13)4-9(10)12/h2-4,6-7,16H,1H3,(H,14,15,17) |
| InChIKey | BERHNXSHSBLTNY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |