C10H8BrN5 — CID 82808948
3-bromo-4-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile (PubChem CID 82808948) has the molecular formula C10H8BrN5 and a molecular weight of 278.11 g/mol. Its IUPAC name is 3-bromo-4-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile.
| Compound Name | 3-bromo-4-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 82808948 |
| Molecular Formula | C10H8BrN5 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 3-bromo-4-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCc2ncn[nH]2)c(Br)c1 |
| InChI | InChI=1S/C10H8BrN5/c11-8-3-7(4-12)1-2-9(8)13-5-10-14-6-15-16-10/h1-3,6,13H,5H2,(H,14,15,16) |
| InChIKey | VLZLUHWCPFDIFZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |