C14H20Cl3N — CID 114168462
2-chloro-N-[(2,4-dichlorophenyl)methyl]-3-ethylpentan-1-amine (PubChem CID 114168462) has the molecular formula C14H20Cl3N and a molecular weight of 308.68 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-dichlorophenyl)methyl]-3-ethylpentan-1-amine.
| Compound Name | 2-chloro-N-[(2,4-dichlorophenyl)methyl]-3-ethylpentan-1-amine |
|---|---|
| PubChem CID | 114168462 |
| Molecular Formula | C14H20Cl3N |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-chloro-N-[(2,4-dichlorophenyl)methyl]-3-ethylpentan-1-amine |
| SMILES | CCC(CC)C(Cl)CNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl3N/c1-3-10(4-2)14(17)9-18-8-11-5-6-12(15)7-13(11)16/h5-7,10,14,18H,3-4,8-9H2,1-2H3 |
| InChIKey | NQSYPEOCKRHWRJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|