C12H19F4N — CID 114169091
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 114169091) has the molecular formula C12H19F4N and a molecular weight of 253.28 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 114169091 |
| Molecular Formula | C12H19F4N |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CC1=CC(C)CC(CNCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C12H19F4N/c1-8-3-9(2)5-10(4-8)6-17-7-12(15,16)11(13)14/h3,8,10-11,17H,4-7H2,1-2H3 |
| InChIKey | WIEUGWJXPMPZAL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|