C11H12F4N2O — CID 114169332
N-phenyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide (PubChem CID 114169332) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is N-phenyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide.
| Compound Name | N-phenyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide |
|---|---|
| PubChem CID | 114169332 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-phenyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)C(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C11H12F4N2O/c12-10(13)11(14,15)7-16-6-9(18)17-8-4-2-1-3-5-8/h1-5,10,16H,6-7H2,(H,17,18) |
| InChIKey | HIWGSLSXBMZKIG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|