C12H18N2O3S — CID 114175400
N-[3-(4-oxo-6,7-dihydro-5H-indol-1-yl)propyl]methanesulfonamide (PubChem CID 114175400) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-[3-(4-oxo-6,7-dihydro-5H-indol-1-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(4-oxo-6,7-dihydro-5H-indol-1-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 114175400 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-[3-(4-oxo-6,7-dihydro-5H-indol-1-yl)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1ccc2c1CCCC2=O |
| InChI | InChI=1S/C12H18N2O3S/c1-18(16,17)13-7-3-8-14-9-6-10-11(14)4-2-5-12(10)15/h6,9,13H,2-5,7-8H2,1H3 |
| InChIKey | ZYUNKXFIYKRNBY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|