About acetonitrile;cyclohexyl(diiodo)borane
acetonitrile;cyclohexyl(diiodo)borane (PubChem CID 11417872) has the molecular formula C8H14BI2N
and a molecular weight of 388.83 g/mol. Its IUPAC name is acetonitrile;cyclohexyl(diiodo)borane.
Molecular Properties
| Compound Name | acetonitrile;cyclohexyl(diiodo)borane |
| PubChem CID | 11417872 |
| Molecular Formula | C8H14BI2N |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | acetonitrile;cyclohexyl(diiodo)borane |
| SMILES | CC#N.IB(I)C1CCCCC1 |
| InChI | InChI=1S/C6H11BI2.C2H3N/c8-7(9)6-4-2-1-3-5-6;1-2-3/h6H,1-5H2;1H3 |
| InChIKey | XDXLWPIDVYFFAZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;cyclohexyl(diiodo)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;cyclohexyl(diiodo)borane?
The IUPAC name of acetonitrile;cyclohexyl(diiodo)borane (CID 11417872) is acetonitrile;cyclohexyl(diiodo)borane.
What is the SMILES notation for acetonitrile;cyclohexyl(diiodo)borane?
The canonical SMILES for acetonitrile;cyclohexyl(diiodo)borane is CC#N.IB(I)C1CCCCC1.
What is the InChIKey of acetonitrile;cyclohexyl(diiodo)borane?
The InChIKey is XDXLWPIDVYFFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BI2.C2H3N/c8-7(9)6-4-2-1-3-5-6;1-2-3/h6H,1-5H2;1H3.
What are the key properties of acetonitrile;cyclohexyl(diiodo)borane?
acetonitrile;cyclohexyl(diiodo)borane has a molecular weight of 388.83 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;cyclohexyl(diiodo)borane is sourced from PubChem (CID 11417872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).