C12H14N4O2 — CID 114180884
3-amino-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzamide (PubChem CID 114180884) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-amino-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzamide.
| Compound Name | 3-amino-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 114180884 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-amino-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzamide |
| SMILES | Cc1cnc(CNc2c(N)cccc2C(N)=O)o1 |
| InChI | InChI=1S/C12H14N4O2/c1-7-5-15-10(18-7)6-16-11-8(12(14)17)3-2-4-9(11)13/h2-5,16H,6,13H2,1H3,(H2,14,17) |
| InChIKey | AOUYCCAGRYYFMJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|