C13H22N2OS — CID 114181296
4-[[(4-ethylcycloheptyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181296) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 4-[[(4-ethylcycloheptyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(4-ethylcycloheptyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181296 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-[[(4-ethylcycloheptyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCC1CCCC(NCc2csc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C13H22N2OS/c1-2-10-4-3-5-11(7-6-10)14-8-12-9-17-13(16)15-12/h9-11,14H,2-8H2,1H3,(H,15,16) |
| InChIKey | OJQILXGPDULSCM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |