C11H17N3OS2 — CID 106380576
1-cyclohexyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]thiourea (PubChem CID 106380576) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 106380576 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-cyclohexyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]thiourea |
| SMILES | O=c1[nH]c(CNC(=S)NC2CCCCC2)cs1 |
| InChI | InChI=1S/C11H17N3OS2/c15-11-14-9(7-17-11)6-12-10(16)13-8-4-2-1-3-5-8/h7-8H,1-6H2,(H,14,15)(H2,12,13,16) |
| InChIKey | VQOWGFHFDKWMRD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|