C11H18N4OS — CID 114181521
1-cyclohexyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 114181521) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 114181521 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-cyclohexyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | N/C(=N\Cc1csc(=O)[nH]1)NC1CCCCC1 |
| InChI | InChI=1S/C11H18N4OS/c12-10(14-8-4-2-1-3-5-8)13-6-9-7-17-11(16)15-9/h7-8H,1-6H2,(H,15,16)(H3,12,13,14) |
| InChIKey | FLKYCMSWGOHVBU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|