C11H16N6 — CID 114182228
4-[5-(pyridin-3-ylmethyl)tetrazol-1-yl]butan-1-amine (PubChem CID 114182228) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-[5-(pyridin-3-ylmethyl)tetrazol-1-yl]butan-1-amine.
| Compound Name | 4-[5-(pyridin-3-ylmethyl)tetrazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 114182228 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 4-[5-(pyridin-3-ylmethyl)tetrazol-1-yl]butan-1-amine |
| SMILES | NCCCCn1nnnc1Cc1cccnc1 |
| InChI | InChI=1S/C11H16N6/c12-5-1-2-7-17-11(14-15-16-17)8-10-4-3-6-13-9-10/h3-4,6,9H,1-2,5,7-8,12H2 |
| InChIKey | CNAWNWQRRVJVSL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|