C10H16N6S — CID 114182255
4-[5-[(4-methyl-1,3-thiazol-2-yl)methyl]tetrazol-1-yl]butan-1-amine (PubChem CID 114182255) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-[5-[(4-methyl-1,3-thiazol-2-yl)methyl]tetrazol-1-yl]butan-1-amine.
| Compound Name | 4-[5-[(4-methyl-1,3-thiazol-2-yl)methyl]tetrazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 114182255 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-[5-[(4-methyl-1,3-thiazol-2-yl)methyl]tetrazol-1-yl]butan-1-amine |
| SMILES | Cc1csc(Cc2nnnn2CCCCN)n1 |
| InChI | InChI=1S/C10H16N6S/c1-8-7-17-10(12-8)6-9-13-14-15-16(9)5-3-2-4-11/h7H,2-6,11H2,1H3 |
| InChIKey | IYCDMCOCDMJSCQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|