C20H24N2O5S — CID 11418272
2-[[formyl(hydroxy)amino]methyl]-4-methyl-N-(4-phenylphenyl)sulfonylpentanamide (PubChem CID 11418272) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[[formyl(hydroxy)amino]methyl]-4-methyl-N-(4-phenylphenyl)sulfonylpentanamide.
| Compound Name | 2-[[formyl(hydroxy)amino]methyl]-4-methyl-N-(4-phenylphenyl)sulfonylpentanamide |
|---|---|
| PubChem CID | 11418272 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[[formyl(hydroxy)amino]methyl]-4-methyl-N-(4-phenylphenyl)sulfonylpentanamide |
| SMILES | CC(C)CC(CN(O)C=O)C(=O)NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-15(2)12-18(13-22(25)14-23)20(24)21-28(26,27)19-10-8-17(9-11-19)16-6-4-3-5-7-16/h3-11,14-15,18,25H,12-13H2,1-2H3,(H,21,24) |
| InChIKey | RUVCDUMKTXSTBT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|