C11H9FN4OS — CID 114184744
6-fluoro-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 114184744) has the molecular formula C11H9FN4OS and a molecular weight of 264.28 g/mol. Its IUPAC name is 6-fluoro-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114184744 |
| Molecular Formula | C11H9FN4OS |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-fluoro-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc2c(c1)[nH]c(=S)n2CCc1ncno1 |
| InChI | InChI=1S/C11H9FN4OS/c12-7-1-2-9-8(5-7)15-11(18)16(9)4-3-10-13-6-14-17-10/h1-2,5-6H,3-4H2,(H,15,18) |
| InChIKey | ZFGICYTVCIIRKE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|