C26H29N3O2 — CID 11418589
3-(hydroxymethyl)-N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzamide (PubChem CID 11418589) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzamide.
| Compound Name | 3-(hydroxymethyl)-N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 11418589 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-(hydroxymethyl)-N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(-c2cccc(CN3CCNCC3)c2)c1)c1cccc(CO)c1 |
| InChI | InChI=1S/C26H29N3O2/c30-19-22-6-3-9-25(16-22)26(31)28-17-20-4-1-7-23(14-20)24-8-2-5-21(15-24)18-29-12-10-27-11-13-29/h1-9,14-16,27,30H,10-13,17-19H2,(H,28,31) |
| InChIKey | MUUPFBRUPYKLFR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |