C12H20N4O — CID 114186188
2,2-dimethyl-5-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]pentanenitrile (PubChem CID 114186188) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]pentanenitrile.
| Compound Name | 2,2-dimethyl-5-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]pentanenitrile |
|---|---|
| PubChem CID | 114186188 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2,2-dimethyl-5-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]pentanenitrile |
| SMILES | Cc1noc(CCNCCCC(C)(C)C#N)n1 |
| InChI | InChI=1S/C12H20N4O/c1-10-15-11(17-16-10)5-8-14-7-4-6-12(2,3)9-13/h14H,4-8H2,1-3H3 |
| InChIKey | OZGOJBRXTVDXRY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|