C14H21N3S — CID 114187719
N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 114187719) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 114187719 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C14H21N3S/c1-2-10-18-11-8-15-12-13-7-9-17(16-13)14-5-3-4-6-14/h1,7,9,14-15H,3-6,8,10-12H2 |
| InChIKey | CRUIJDKQHYBMFB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|