C16H27IO3Si — CID 11418784
(2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one (PubChem CID 11418784) has the molecular formula C16H27IO3Si and a molecular weight of 422.38 g/mol. Its IUPAC name is (2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 11418784 |
| Molecular Formula | C16H27IO3Si |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one |
| SMILES | C[C@H]1C=C(C[C@@H](C/C=C/I)O[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C16H27IO3Si/c1-12-10-13(15(18)19-12)11-14(8-7-9-17)20-21(5,6)16(2,3)4/h7,9-10,12,14H,8,11H2,1-6H3/b9-7+/t12-,14+/m0/s1 |
| InChIKey | SOQIVCZBBVTCCC-GKUAPZSJSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|