C13H19N3OS — CID 114188500
2-[(2-propylpyrazol-3-yl)methylamino]-1-thiophen-3-ylethanol (PubChem CID 114188500) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-[(2-propylpyrazol-3-yl)methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(2-propylpyrazol-3-yl)methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 114188500 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[(2-propylpyrazol-3-yl)methylamino]-1-thiophen-3-ylethanol |
| SMILES | CCCn1nccc1CNCC(O)c1ccsc1 |
| InChI | InChI=1S/C13H19N3OS/c1-2-6-16-12(3-5-15-16)8-14-9-13(17)11-4-7-18-10-11/h3-5,7,10,13-14,17H,2,6,8-9H2,1H3 |
| InChIKey | VXNBYLHLVFJRSQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |