C17H22O2 — CID 114190057
6,6-dimethyl-2-[(4-methylphenyl)methyl]hept-4-ynoic acid (PubChem CID 114190057) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6,6-dimethyl-2-[(4-methylphenyl)methyl]hept-4-ynoic acid.
| Compound Name | 6,6-dimethyl-2-[(4-methylphenyl)methyl]hept-4-ynoic acid |
|---|---|
| PubChem CID | 114190057 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 6,6-dimethyl-2-[(4-methylphenyl)methyl]hept-4-ynoic acid |
| SMILES | Cc1ccc(CC(CC#CC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H22O2/c1-13-7-9-14(10-8-13)12-15(16(18)19)6-5-11-17(2,3)4/h7-10,15H,6,12H2,1-4H3,(H,18,19) |
| InChIKey | PYKLIOLZZWZKCY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|