C13H12FNO4 — CID 114193746
ethyl 5-(2-fluoro-5-nitrophenyl)penta-2,4-dienoate (PubChem CID 114193746) has the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. Its IUPAC name is ethyl 5-(2-fluoro-5-nitrophenyl)penta-2,4-dienoate.
| Compound Name | ethyl 5-(2-fluoro-5-nitrophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 114193746 |
| Molecular Formula | C13H12FNO4 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | ethyl 5-(2-fluoro-5-nitrophenyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=Cc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C13H12FNO4/c1-2-19-13(16)6-4-3-5-10-9-11(15(17)18)7-8-12(10)14/h3-9H,2H2,1H3 |
| InChIKey | WOIPHBIJHUVNCX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|