C12H19N3O3 — CID 114194899
ethyl 2-amino-5-[2-methoxyethyl(methyl)amino]pyridine-4-carboxylate (PubChem CID 114194899) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-amino-5-[2-methoxyethyl(methyl)amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-amino-5-[2-methoxyethyl(methyl)amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 114194899 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | ethyl 2-amino-5-[2-methoxyethyl(methyl)amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(N)ncc1N(C)CCOC |
| InChI | InChI=1S/C12H19N3O3/c1-4-18-12(16)9-7-11(13)14-8-10(9)15(2)5-6-17-3/h7-8H,4-6H2,1-3H3,(H2,13,14) |
| InChIKey | IIBUCQWWQVTDRU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |