C19H20N3O8P — CID 11419525
(4aR,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide (PubChem CID 11419525) has the molecular formula C19H20N3O8P and a molecular weight of 449.36 g/mol. Its IUPAC name is (4aR,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide.
| Compound Name | (4aR,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide |
|---|---|
| PubChem CID | 11419525 |
| Molecular Formula | C19H20N3O8P |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (4aR,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide |
| SMILES | O=[N+]([O-])c1ccc(OP2(=O)OC[C@H]3CCN(Cc4ccccc4)C[C@@H]3O2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N3O8P/c23-21(24)16-6-7-18(17(10-16)22(25)26)29-31(27)28-13-15-8-9-20(12-19(15)30-31)11-14-4-2-1-3-5-14/h1-7,10,15,19H,8-9,11-13H2/t15-,19+,31?/m1/s1 |
| InChIKey | UJIPIWIJMFJQEA-WJDHZVMSSA-N |
| XLogP | 3.93 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|