C20H23N3O8P+ — CID 11354006
(4aS,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-7-methyl-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridin-7-ium 2-oxide (PubChem CID 11354006) has the molecular formula C20H23N3O8P+ and a molecular weight of 464.39 g/mol. Its IUPAC name is (4aS,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-7-methyl-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridin-7-ium 2-oxide.
| Compound Name | (4aS,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-7-methyl-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridin-7-ium 2-oxide |
|---|---|
| PubChem CID | 11354006 |
| Molecular Formula | C20H23N3O8P+ |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (4aS,8aR)-7-benzyl-2-(2,4-dinitrophenoxy)-7-methyl-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridin-7-ium 2-oxide |
| SMILES | C[N+]1(Cc2ccccc2)CC[C@H]2COP(=O)(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])O[C@H]2C1 |
| InChI | InChI=1S/C20H23N3O8P/c1-23(12-15-5-3-2-4-6-15)10-9-16-14-29-32(28,31-20(16)13-23)30-19-8-7-17(21(24)25)11-18(19)22(26)27/h2-8,11,16,20H,9-10,12-14H2,1H3/q+1/t16-,20-,23?,32?/m0/s1 |
| InChIKey | WFELINOBHGIRCA-TZGSQXKXSA-N |
| XLogP | 4.07 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|