About N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine
N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine (PubChem CID 2825230) has the molecular formula C17H17N3O5
and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine.
Molecular Properties
| Compound Name | N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine |
| PubChem CID | 2825230 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine |
| SMILES | CC(C)(C)C(=NOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H17N3O5/c1-17(2,3)16(12-7-5-4-6-8-12)18-25-15-10-9-13(19(21)22)11-14(15)20(23)24/h4-11H,1-3H3 |
| InChIKey | RWAMUGICPPTWFD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 107.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine?
The IUPAC name of N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine (CID 2825230) is N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine.
What is the SMILES notation for N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine?
The canonical SMILES for N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine is CC(C)(C)C(=NOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1.
What is the InChIKey of N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine?
The InChIKey is RWAMUGICPPTWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O5/c1-17(2,3)16(12-7-5-4-6-8-12)18-25-15-10-9-13(19(21)22)11-14(15)20(23)24/h4-11H,1-3H3.
What are the key properties of N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine?
N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine has a molecular weight of 343.34 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine is sourced from PubChem (CID 2825230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).