C17H17N3O5 — CID 2825230
N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine (PubChem CID 2825230) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine.
| Compound Name | N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 2825230 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2,4-dinitrophenoxy)-2,2-dimethyl-1-phenylpropan-1-imine |
| SMILES | CC(C)(C)C(=NOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H17N3O5/c1-17(2,3)16(12-7-5-4-6-8-12)18-25-15-10-9-13(19(21)22)11-14(15)20(23)24/h4-11H,1-3H3 |
| InChIKey | RWAMUGICPPTWFD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 107.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|