C27H26N4O7 — CID 70678072
ethyl (5E)-2-(benzhydrylideneamino)-5-(2,4-dinitrophenoxy)iminohexanoate (PubChem CID 70678072) has the molecular formula C27H26N4O7 and a molecular weight of 518.53 g/mol. Its IUPAC name is ethyl (5E)-2-(benzhydrylideneamino)-5-(2,4-dinitrophenoxy)iminohexanoate.
| Compound Name | ethyl (5E)-2-(benzhydrylideneamino)-5-(2,4-dinitrophenoxy)iminohexanoate |
|---|---|
| PubChem CID | 70678072 |
| Molecular Formula | C27H26N4O7 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | ethyl (5E)-2-(benzhydrylideneamino)-5-(2,4-dinitrophenoxy)iminohexanoate |
| SMILES | CCOC(=O)C(CC/C(C)=N/Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O7/c1-3-37-27(32)23(28-26(20-10-6-4-7-11-20)21-12-8-5-9-13-21)16-14-19(2)29-38-25-17-15-22(30(33)34)18-24(25)31(35)36/h4-13,15,17-18,23H,3,14,16H2,1-2H3/b29-19+ |
| InChIKey | GZORESJMLJVWJZ-VUTHCHCSSA-N |
| XLogP | 5.51 |
| TPSA | 146.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|