C19H19N3O8 — CID 15832505
3-[[(5E)-5-(2,4-dinitrophenoxy)imino-2,2-dimethyl-1,3-dioxan-4-yl]methyl]phenol (PubChem CID 15832505) has the molecular formula C19H19N3O8 and a molecular weight of 417.37 g/mol. Its IUPAC name is 3-[[(5E)-5-(2,4-dinitrophenoxy)imino-2,2-dimethyl-1,3-dioxan-4-yl]methyl]phenol.
| Compound Name | 3-[[(5E)-5-(2,4-dinitrophenoxy)imino-2,2-dimethyl-1,3-dioxan-4-yl]methyl]phenol |
|---|---|
| PubChem CID | 15832505 |
| Molecular Formula | C19H19N3O8 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-[[(5E)-5-(2,4-dinitrophenoxy)imino-2,2-dimethyl-1,3-dioxan-4-yl]methyl]phenol |
| SMILES | CC1(C)OC/C(=N\Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(Cc2cccc(O)c2)O1 |
| InChI | InChI=1S/C19H19N3O8/c1-19(2)28-11-15(18(29-19)9-12-4-3-5-14(23)8-12)20-30-17-7-6-13(21(24)25)10-16(17)22(26)27/h3-8,10,18,23H,9,11H2,1-2H3/b20-15+ |
| InChIKey | REYFITARHHDPGX-HMMYKYKNSA-N |
| XLogP | 3.34 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|