C13H17FNO3P — CID 53360331
(2R,4aS,8aS)-7-benzyl-2-fluoro-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide (PubChem CID 53360331) has the molecular formula C13H17FNO3P and a molecular weight of 285.25 g/mol. Its IUPAC name is (2R,4aS,8aS)-7-benzyl-2-fluoro-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide.
| Compound Name | (2R,4aS,8aS)-7-benzyl-2-fluoro-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide |
|---|---|
| PubChem CID | 53360331 |
| Molecular Formula | C13H17FNO3P |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (2R,4aS,8aS)-7-benzyl-2-fluoro-4,4a,5,6,8,8a-hexahydro-[1,3,2]dioxaphosphinino[4,5-c]pyridine 2-oxide |
| SMILES | O=[P@@]1(F)OC[C@@H]2CCN(Cc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C13H17FNO3P/c14-19(16)17-10-12-6-7-15(9-13(12)18-19)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13+,19-/m0/s1 |
| InChIKey | UDOVYVBTTKIDJP-QUJCMNEKSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|