C15H25BrN2 — CID 114200874
2-N-(3-bromo-5-methylphenyl)-3,5-dimethylhexane-1,2-diamine (PubChem CID 114200874) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-N-(3-bromo-5-methylphenyl)-3,5-dimethylhexane-1,2-diamine.
| Compound Name | 2-N-(3-bromo-5-methylphenyl)-3,5-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 114200874 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-N-(3-bromo-5-methylphenyl)-3,5-dimethylhexane-1,2-diamine |
| SMILES | Cc1cc(Br)cc(NC(CN)C(C)CC(C)C)c1 |
| InChI | InChI=1S/C15H25BrN2/c1-10(2)5-12(4)15(9-17)18-14-7-11(3)6-13(16)8-14/h6-8,10,12,15,18H,5,9,17H2,1-4H3 |
| InChIKey | KCIMYECUCNVURR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |