C12H17BrN2 — CID 107582921
N-(3-bromo-5-methylphenyl)-1-cyclopropylethane-1,2-diamine (PubChem CID 107582921) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-1-cyclopropylethane-1,2-diamine.
| Compound Name | N-(3-bromo-5-methylphenyl)-1-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 107582921 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-1-cyclopropylethane-1,2-diamine |
| SMILES | Cc1cc(Br)cc(NC(CN)C2CC2)c1 |
| InChI | InChI=1S/C12H17BrN2/c1-8-4-10(13)6-11(5-8)15-12(7-14)9-2-3-9/h4-6,9,12,15H,2-3,7,14H2,1H3 |
| InChIKey | GSSZTTKSFNOHHI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |