C16H24FNO — CID 79047274
2-(3-fluoro-5-methylanilino)-2-(4-methylcyclohexyl)ethanol (PubChem CID 79047274) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is 2-(3-fluoro-5-methylanilino)-2-(4-methylcyclohexyl)ethanol.
| Compound Name | 2-(3-fluoro-5-methylanilino)-2-(4-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 79047274 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-(3-fluoro-5-methylanilino)-2-(4-methylcyclohexyl)ethanol |
| SMILES | Cc1cc(F)cc(NC(CO)C2CCC(C)CC2)c1 |
| InChI | InChI=1S/C16H24FNO/c1-11-3-5-13(6-4-11)16(10-19)18-15-8-12(2)7-14(17)9-15/h7-9,11,13,16,18-19H,3-6,10H2,1-2H3 |
| InChIKey | CFDDEAKABMOXGL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |