C23H31N3O8 — CID 11420170
N-methyl-N-(4-piperidin-1-ylbutyl)quinolin-4-amine;oxalic acid (PubChem CID 11420170) has the molecular formula C23H31N3O8 and a molecular weight of 477.51 g/mol. Its IUPAC name is N-methyl-N-(4-piperidin-1-ylbutyl)quinolin-4-amine;oxalic acid.
| Compound Name | N-methyl-N-(4-piperidin-1-ylbutyl)quinolin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 11420170 |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-methyl-N-(4-piperidin-1-ylbutyl)quinolin-4-amine;oxalic acid |
| SMILES | CN(CCCCN1CCCCC1)c1ccnc2ccccc12.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H27N3.2C2H2O4/c1-21(13-7-8-16-22-14-5-2-6-15-22)19-11-12-20-18-10-4-3-9-17(18)19;2*3-1(4)2(5)6/h3-4,9-12H,2,5-8,13-16H2,1H3;2*(H,3,4)(H,5,6) |
| InChIKey | DMKXELLZTDRDEN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|