C32H42ClN5 — CID 118735292
N-(7-chloroquinolin-4-yl)-N,N'-bis(3-piperidin-1-ylpropyl)benzenecarboximidamide (PubChem CID 118735292) has the molecular formula C32H42ClN5 and a molecular weight of 532.18 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N,N'-bis(3-piperidin-1-ylpropyl)benzenecarboximidamide.
| Compound Name | N-(7-chloroquinolin-4-yl)-N,N'-bis(3-piperidin-1-ylpropyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 118735292 |
| Molecular Formula | C32H42ClN5 |
| Molecular Weight | 532.18 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N,N'-bis(3-piperidin-1-ylpropyl)benzenecarboximidamide |
| SMILES | Clc1ccc2c(N(CCCN3CCCCC3)/C(=N/CCCN3CCCCC3)c3ccccc3)ccnc2c1 |
| InChI | InChI=1S/C32H42ClN5/c33-28-14-15-29-30(26-28)34-18-16-31(29)38(25-11-24-37-21-8-3-9-22-37)32(27-12-4-1-5-13-27)35-17-10-23-36-19-6-2-7-20-36/h1,4-5,12-16,18,26H,2-3,6-11,17,19-25H2/b35-32+ |
| InChIKey | OSIUGAGIICLMOK-LVYIWIAJSA-N |
| XLogP | 6.89 |
| TPSA | 34.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.18 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|